C17H13ClFN3O3 — CID 47037719
7-chloro-N-[2-(2-cyano-3-fluoroanilino)ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 47037719) has the molecular formula C17H13ClFN3O3 and a molecular weight of 361.76 g/mol. Its IUPAC name is 7-chloro-N-[2-(2-cyano-3-fluoroanilino)ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | 7-chloro-N-[2-(2-cyano-3-fluoroanilino)ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 47037719 |
| Molecular Formula | C17H13ClFN3O3 |
| Molecular Weight | 361.76 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 7-chloro-N-[2-(2-cyano-3-fluoroanilino)ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | N#Cc1c(F)cccc1NCCNC(=O)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C17H13ClFN3O3/c18-12-6-10(7-15-16(12)25-9-24-15)17(23)22-5-4-21-14-3-1-2-13(19)11(14)8-20/h1-3,6-7,21H,4-5,9H2,(H,22,23) |
| InChIKey | UUHAVMGKHQLZRO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.76 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|