C17H13ClF3N3O5 — CID 24549850
7-chloro-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 24549850) has the molecular formula C17H13ClF3N3O5 and a molecular weight of 431.75 g/mol. Its IUPAC name is 7-chloro-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | 7-chloro-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 24549850 |
| Molecular Formula | C17H13ClF3N3O5 |
| Molecular Weight | 431.75 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 7-chloro-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C17H13ClF3N3O5/c18-11-5-9(6-14-15(11)29-8-28-14)16(25)23-4-3-22-12-2-1-10(17(19,20)21)7-13(12)24(26)27/h1-2,5-7,22H,3-4,8H2,(H,23,25) |
| InChIKey | KTJBJWLHCAICBG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.75 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|