C16H14ClF3N4O3 — CID 67757758
4-chloro-N'-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]benzohydrazide (PubChem CID 67757758) has the molecular formula C16H14ClF3N4O3 and a molecular weight of 402.76 g/mol. Its IUPAC name is 4-chloro-N'-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]benzohydrazide |
|---|---|
| PubChem CID | 67757758 |
| Molecular Formula | C16H14ClF3N4O3 |
| Molecular Weight | 402.76 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 4-chloro-N'-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]benzohydrazide |
| SMILES | O=C(NNCCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClF3N4O3/c17-12-4-1-10(2-5-12)15(25)23-22-8-7-21-13-6-3-11(16(18,19)20)9-14(13)24(26)27/h1-6,9,21-22H,7-8H2,(H,23,25) |
| InChIKey | NMERDYCPCYKIIE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.76 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|