C17H16F3N5O5 — CID 24549856
2-(methylamino)-5-nitro-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]benzamide (PubChem CID 24549856) has the molecular formula C17H16F3N5O5 and a molecular weight of 427.34 g/mol. Its IUPAC name is 2-(methylamino)-5-nitro-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]benzamide.
| Compound Name | 2-(methylamino)-5-nitro-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 24549856 |
| Molecular Formula | C17H16F3N5O5 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-(methylamino)-5-nitro-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]benzamide |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)NCCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16F3N5O5/c1-21-13-5-3-11(24(27)28)9-12(13)16(26)23-7-6-22-14-4-2-10(17(18,19)20)8-15(14)25(29)30/h2-5,8-9,21-22H,6-7H2,1H3,(H,23,26) |
| InChIKey | PHDJDZMZFMAWAC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|