C17H17FN4O4 — CID 86839616
2-[2-[(4-fluorobenzoyl)amino]ethylamino]-N-methyl-5-nitrobenzamide (PubChem CID 86839616) has the molecular formula C17H17FN4O4 and a molecular weight of 360.35 g/mol. Its IUPAC name is 2-[2-[(4-fluorobenzoyl)amino]ethylamino]-N-methyl-5-nitrobenzamide.
| Compound Name | 2-[2-[(4-fluorobenzoyl)amino]ethylamino]-N-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 86839616 |
| Molecular Formula | C17H17FN4O4 |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-[2-[(4-fluorobenzoyl)amino]ethylamino]-N-methyl-5-nitrobenzamide |
| SMILES | CNC(=O)c1cc([N+](=O)[O-])ccc1NCCNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN4O4/c1-19-17(24)14-10-13(22(25)26)6-7-15(14)20-8-9-21-16(23)11-2-4-12(18)5-3-11/h2-7,10,20H,8-9H2,1H3,(H,19,24)(H,21,23) |
| InChIKey | XYPHYSXNCTWVGS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|