C17H18FN3O3S — CID 87020745
2-[3-(4-fluorophenyl)sulfanylpropylamino]-N-methyl-5-nitrobenzamide (PubChem CID 87020745) has the molecular formula C17H18FN3O3S and a molecular weight of 363.41 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)sulfanylpropylamino]-N-methyl-5-nitrobenzamide.
| Compound Name | 2-[3-(4-fluorophenyl)sulfanylpropylamino]-N-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 87020745 |
| Molecular Formula | C17H18FN3O3S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-[3-(4-fluorophenyl)sulfanylpropylamino]-N-methyl-5-nitrobenzamide |
| SMILES | CNC(=O)c1cc([N+](=O)[O-])ccc1NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN3O3S/c1-19-17(22)15-11-13(21(23)24)5-8-16(15)20-9-2-10-25-14-6-3-12(18)4-7-14/h3-8,11,20H,2,9-10H2,1H3,(H,19,22) |
| InChIKey | XZZWKGSGXMYUHG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|