C17H17F3N4O5S — CID 24661935
N-[2-[4-(methylsulfamoyl)-2-nitroanilino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 24661935) has the molecular formula C17H17F3N4O5S and a molecular weight of 446.41 g/mol. Its IUPAC name is N-[2-[4-(methylsulfamoyl)-2-nitroanilino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[4-(methylsulfamoyl)-2-nitroanilino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 24661935 |
| Molecular Formula | C17H17F3N4O5S |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | N-[2-[4-(methylsulfamoyl)-2-nitroanilino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(NCCNC(=O)c2ccc(C(F)(F)F)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17F3N4O5S/c1-21-30(28,29)13-6-7-14(15(10-13)24(26)27)22-8-9-23-16(25)11-2-4-12(5-3-11)17(18,19)20/h2-7,10,21-22H,8-9H2,1H3,(H,23,25) |
| InChIKey | MJWWJASLXWETAV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|