C18H15F3N4O6 — CID 55405694
N'-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 55405694) has the molecular formula C18H15F3N4O6 and a molecular weight of 440.33 g/mol. Its IUPAC name is N'-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 55405694 |
| Molecular Formula | C18H15F3N4O6 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | N'-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15F3N4O6/c19-18(20,21)11-2-3-12(13(8-11)25(28)29)22-6-5-16(26)23-24-17(27)10-1-4-14-15(7-10)31-9-30-14/h1-4,7-8,22H,5-6,9H2,(H,23,26)(H,24,27) |
| InChIKey | UMSMKEYZRGSJRB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|