C17H14BrF3N4O4 — CID 46523689
2-bromo-N'-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]benzohydrazide (PubChem CID 46523689) has the molecular formula C17H14BrF3N4O4 and a molecular weight of 475.22 g/mol. Its IUPAC name is 2-bromo-N'-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]benzohydrazide.
| Compound Name | 2-bromo-N'-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 46523689 |
| Molecular Formula | C17H14BrF3N4O4 |
| Molecular Weight | 475.22 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | 2-bromo-N'-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]benzohydrazide |
| SMILES | O=C(CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])NNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C17H14BrF3N4O4/c18-12-4-2-1-3-11(12)16(27)24-23-15(26)7-8-22-13-6-5-10(17(19,20)21)9-14(13)25(28)29/h1-6,9,22H,7-8H2,(H,23,26)(H,24,27) |
| InChIKey | CDLZJZRYZVJUJN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|