C18H14Cl2F3N3O3 — CID 2900278
3-(2,4-dichlorophenyl)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]prop-2-enamide (PubChem CID 2900278) has the molecular formula C18H14Cl2F3N3O3 and a molecular weight of 448.23 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]prop-2-enamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 2900278 |
| Molecular Formula | C18H14Cl2F3N3O3 |
| Molecular Weight | 448.23 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)NCCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14Cl2F3N3O3/c19-13-4-1-11(14(20)10-13)2-6-17(27)25-8-7-24-15-5-3-12(18(21,22)23)9-16(15)26(28)29/h1-6,9-10,24H,7-8H2,(H,25,27) |
| InChIKey | GECSXJOABCUYCE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.23 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|