C17H14Cl3N3O3 — CID 5292076
(E)-N-[2-(2-chloro-6-nitroanilino)ethyl]-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 5292076) has the molecular formula C17H14Cl3N3O3 and a molecular weight of 414.68 g/mol. Its IUPAC name is (E)-N-[2-(2-chloro-6-nitroanilino)ethyl]-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(2-chloro-6-nitroanilino)ethyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5292076 |
| Molecular Formula | C17H14Cl3N3O3 |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | (E)-N-[2-(2-chloro-6-nitroanilino)ethyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)NCCNc1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14Cl3N3O3/c18-12-6-4-11(14(20)10-12)5-7-16(24)21-8-9-22-17-13(19)2-1-3-15(17)23(25)26/h1-7,10,22H,8-9H2,(H,21,24)/b7-5+ |
| InChIKey | ZWNBQTNGLDYXFJ-FNORWQNLSA-N |
| XLogP | 4.80 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|