C19H17Cl2FN4O2 — CID 55843475
2,3-dichloro-N-[1-[2-(2-cyano-3-fluoroanilino)ethylamino]-1-oxopropan-2-yl]benzamide (PubChem CID 55843475) has the molecular formula C19H17Cl2FN4O2 and a molecular weight of 423.28 g/mol. Its IUPAC name is 2,3-dichloro-N-[1-[2-(2-cyano-3-fluoroanilino)ethylamino]-1-oxopropan-2-yl]benzamide.
| Compound Name | 2,3-dichloro-N-[1-[2-(2-cyano-3-fluoroanilino)ethylamino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 55843475 |
| Molecular Formula | C19H17Cl2FN4O2 |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 2,3-dichloro-N-[1-[2-(2-cyano-3-fluoroanilino)ethylamino]-1-oxopropan-2-yl]benzamide |
| SMILES | CC(NC(=O)c1cccc(Cl)c1Cl)C(=O)NCCNc1cccc(F)c1C#N |
| InChI | InChI=1S/C19H17Cl2FN4O2/c1-11(26-19(28)12-4-2-5-14(20)17(12)21)18(27)25-9-8-24-16-7-3-6-15(22)13(16)10-23/h2-7,11,24H,8-9H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | LNKICBBWWFNZBO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|