C18H17BrFN3OS — CID 55972616
3-(2-bromophenyl)sulfanyl-N-[2-(2-cyano-3-fluoroanilino)ethyl]propanamide (PubChem CID 55972616) has the molecular formula C18H17BrFN3OS and a molecular weight of 422.32 g/mol. Its IUPAC name is 3-(2-bromophenyl)sulfanyl-N-[2-(2-cyano-3-fluoroanilino)ethyl]propanamide.
| Compound Name | 3-(2-bromophenyl)sulfanyl-N-[2-(2-cyano-3-fluoroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 55972616 |
| Molecular Formula | C18H17BrFN3OS |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 3-(2-bromophenyl)sulfanyl-N-[2-(2-cyano-3-fluoroanilino)ethyl]propanamide |
| SMILES | N#Cc1c(F)cccc1NCCNC(=O)CCSc1ccccc1Br |
| InChI | InChI=1S/C18H17BrFN3OS/c19-14-4-1-2-7-17(14)25-11-8-18(24)23-10-9-22-16-6-3-5-15(20)13(16)12-21/h1-7,22H,8-11H2,(H,23,24) |
| InChIKey | QWTBKRIPOZDACB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|