C12H16FNO2S — CID 43417674
3-(2-fluorophenyl)sulfanyl-N-(3-hydroxypropyl)propanamide (PubChem CID 43417674) has the molecular formula C12H16FNO2S and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-(2-fluorophenyl)sulfanyl-N-(3-hydroxypropyl)propanamide.
| Compound Name | 3-(2-fluorophenyl)sulfanyl-N-(3-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 43417674 |
| Molecular Formula | C12H16FNO2S |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 3-(2-fluorophenyl)sulfanyl-N-(3-hydroxypropyl)propanamide |
| SMILES | O=C(CCSc1ccccc1F)NCCCO |
| InChI | InChI=1S/C12H16FNO2S/c13-10-4-1-2-5-11(10)17-9-6-12(16)14-7-3-8-15/h1-2,4-5,15H,3,6-9H2,(H,14,16) |
| InChIKey | GHXGXZPTQBNIRT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|