C12H16BrNO2S — CID 110902902
3-(4-bromophenyl)sulfanyl-N-(3-hydroxypropyl)propanamide (PubChem CID 110902902) has the molecular formula C12H16BrNO2S and a molecular weight of 318.24 g/mol. Its IUPAC name is 3-(4-bromophenyl)sulfanyl-N-(3-hydroxypropyl)propanamide.
| Compound Name | 3-(4-bromophenyl)sulfanyl-N-(3-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 110902902 |
| Molecular Formula | C12H16BrNO2S |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 3-(4-bromophenyl)sulfanyl-N-(3-hydroxypropyl)propanamide |
| SMILES | O=C(CCSc1ccc(Br)cc1)NCCCO |
| InChI | InChI=1S/C12H16BrNO2S/c13-10-2-4-11(5-3-10)17-9-6-12(16)14-7-1-8-15/h2-5,15H,1,6-9H2,(H,14,16) |
| InChIKey | BQGULRGHUPTATJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|