C13H20BrClN2OS — CID 120829429
3-(4-bromophenyl)sulfanyl-N-[2-(methylamino)propyl]propanamide;hydrochloride (PubChem CID 120829429) has the molecular formula C13H20BrClN2OS and a molecular weight of 367.74 g/mol. Its IUPAC name is 3-(4-bromophenyl)sulfanyl-N-[2-(methylamino)propyl]propanamide;hydrochloride.
| Compound Name | 3-(4-bromophenyl)sulfanyl-N-[2-(methylamino)propyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120829429 |
| Molecular Formula | C13H20BrClN2OS |
| Molecular Weight | 367.74 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 3-(4-bromophenyl)sulfanyl-N-[2-(methylamino)propyl]propanamide;hydrochloride |
| SMILES | CNC(C)CNC(=O)CCSc1ccc(Br)cc1.Cl |
| InChI | InChI=1S/C13H19BrN2OS.ClH/c1-10(15-2)9-16-13(17)7-8-18-12-5-3-11(14)4-6-12;/h3-6,10,15H,7-9H2,1-2H3,(H,16,17);1H |
| InChIKey | KWPZXDINDQQUFO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.74 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |