C13H18BrNO2S — CID 18369006
3-(4-bromophenyl)sulfanyl-N-[(2-methylpropan-2-yl)oxy]propanamide (PubChem CID 18369006) has the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. Its IUPAC name is 3-(4-bromophenyl)sulfanyl-N-[(2-methylpropan-2-yl)oxy]propanamide.
| Compound Name | 3-(4-bromophenyl)sulfanyl-N-[(2-methylpropan-2-yl)oxy]propanamide |
|---|---|
| PubChem CID | 18369006 |
| Molecular Formula | C13H18BrNO2S |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 3-(4-bromophenyl)sulfanyl-N-[(2-methylpropan-2-yl)oxy]propanamide |
| SMILES | CC(C)(C)ONC(=O)CCSc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H18BrNO2S/c1-13(2,3)17-15-12(16)8-9-18-11-6-4-10(14)5-7-11/h4-7H,8-9H2,1-3H3,(H,15,16) |
| InChIKey | XRUPQGKUGCHKJG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|