C19H22FNO2S — CID 38712022
3-(2-fluorophenyl)sulfanyl-N-[2-(2-methoxy-5-methylphenyl)ethyl]propanamide (PubChem CID 38712022) has the molecular formula C19H22FNO2S and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-(2-fluorophenyl)sulfanyl-N-[2-(2-methoxy-5-methylphenyl)ethyl]propanamide.
| Compound Name | 3-(2-fluorophenyl)sulfanyl-N-[2-(2-methoxy-5-methylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 38712022 |
| Molecular Formula | C19H22FNO2S |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 3-(2-fluorophenyl)sulfanyl-N-[2-(2-methoxy-5-methylphenyl)ethyl]propanamide |
| SMILES | COc1ccc(C)cc1CCNC(=O)CCSc1ccccc1F |
| InChI | InChI=1S/C19H22FNO2S/c1-14-7-8-17(23-2)15(13-14)9-11-21-19(22)10-12-24-18-6-4-3-5-16(18)20/h3-8,13H,9-12H2,1-2H3,(H,21,22) |
| InChIKey | FSBGTHYNQOOUMW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |