C22H27FN2O3 — CID 74617762
2-fluoro-N-[1-[2-(2-methoxy-5-methylphenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 74617762) has the molecular formula C22H27FN2O3 and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-fluoro-N-[1-[2-(2-methoxy-5-methylphenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-fluoro-N-[1-[2-(2-methoxy-5-methylphenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 74617762 |
| Molecular Formula | C22H27FN2O3 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2-fluoro-N-[1-[2-(2-methoxy-5-methylphenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | COc1ccc(C)cc1CCNC(=O)C(NC(=O)c1ccccc1F)C(C)C |
| InChI | InChI=1S/C22H27FN2O3/c1-14(2)20(25-21(26)17-7-5-6-8-18(17)23)22(27)24-12-11-16-13-15(3)9-10-19(16)28-4/h5-10,13-14,20H,11-12H2,1-4H3,(H,24,27)(H,25,26) |
| InChIKey | AFMCQIMZMBZZCL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |