C21H17F4N5O — CID 55844623
N-[2-(2-cyano-3-fluoroanilino)ethyl]-1-(2-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 55844623) has the molecular formula C21H17F4N5O and a molecular weight of 431.39 g/mol. Its IUPAC name is N-[2-(2-cyano-3-fluoroanilino)ethyl]-1-(2-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[2-(2-cyano-3-fluoroanilino)ethyl]-1-(2-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55844623 |
| Molecular Formula | C21H17F4N5O |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[2-(2-cyano-3-fluoroanilino)ethyl]-1-(2-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Cc1ccccc1-n1ncc(C(=O)NCCNc2cccc(F)c2C#N)c1C(F)(F)F |
| InChI | InChI=1S/C21H17F4N5O/c1-13-5-2-3-8-18(13)30-19(21(23,24)25)15(12-29-30)20(31)28-10-9-27-17-7-4-6-16(22)14(17)11-26/h2-8,12,27H,9-10H2,1H3,(H,28,31) |
| InChIKey | ADUASVNGMOUILQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|