C20H15F3N4O2 — CID 154806675
N-(5-cyano-2-methoxyphenyl)-1-(2-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 154806675) has the molecular formula C20H15F3N4O2 and a molecular weight of 400.36 g/mol. Its IUPAC name is N-(5-cyano-2-methoxyphenyl)-1-(2-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-(5-cyano-2-methoxyphenyl)-1-(2-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 154806675 |
| Molecular Formula | C20H15F3N4O2 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-(5-cyano-2-methoxyphenyl)-1-(2-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | COc1ccc(C#N)cc1NC(=O)c1cnn(-c2ccccc2C)c1C(F)(F)F |
| InChI | InChI=1S/C20H15F3N4O2/c1-12-5-3-4-6-16(12)27-18(20(21,22)23)14(11-25-27)19(28)26-15-9-13(10-24)7-8-17(15)29-2/h3-9,11H,1-2H3,(H,26,28) |
| InChIKey | KHBKSEMXHBRHQW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |