C20H15FN4O3 — CID 49182482
N-(5-cyano-2-methoxyphenyl)-1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide (PubChem CID 49182482) has the molecular formula C20H15FN4O3 and a molecular weight of 378.36 g/mol. Its IUPAC name is N-(5-cyano-2-methoxyphenyl)-1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide.
| Compound Name | N-(5-cyano-2-methoxyphenyl)-1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 49182482 |
| Molecular Formula | C20H15FN4O3 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | N-(5-cyano-2-methoxyphenyl)-1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide |
| SMILES | COc1ccc(C#N)cc1NC(=O)c1nn(-c2ccccc2F)c(C)cc1=O |
| InChI | InChI=1S/C20H15FN4O3/c1-12-9-17(26)19(24-25(12)16-6-4-3-5-14(16)21)20(27)23-15-10-13(11-22)7-8-18(15)28-2/h3-10H,1-2H3,(H,23,27) |
| InChIKey | YHCLKAYILNTIRX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |