C19H16FN3O2S — CID 9180345
1-(2-fluorophenyl)-6-methyl-N-(4-methylsulfanylphenyl)-4-oxopyridazine-3-carboxamide (PubChem CID 9180345) has the molecular formula C19H16FN3O2S and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-6-methyl-N-(4-methylsulfanylphenyl)-4-oxopyridazine-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-6-methyl-N-(4-methylsulfanylphenyl)-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 9180345 |
| Molecular Formula | C19H16FN3O2S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 1-(2-fluorophenyl)-6-methyl-N-(4-methylsulfanylphenyl)-4-oxopyridazine-3-carboxamide |
| SMILES | CSc1ccc(NC(=O)c2nn(-c3ccccc3F)c(C)cc2=O)cc1 |
| InChI | InChI=1S/C19H16FN3O2S/c1-12-11-17(24)18(22-23(12)16-6-4-3-5-15(16)20)19(25)21-13-7-9-14(26-2)10-8-13/h3-11H,1-2H3,(H,21,25) |
| InChIKey | CUPXPFIXBCSVMD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |