C20H14FN3O2 — CID 18147874
N-(3-ethynylphenyl)-1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide (PubChem CID 18147874) has the molecular formula C20H14FN3O2 and a molecular weight of 347.35 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide.
| Compound Name | N-(3-ethynylphenyl)-1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 18147874 |
| Molecular Formula | C20H14FN3O2 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-(3-ethynylphenyl)-1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)c2nn(-c3ccccc3F)c(C)cc2=O)c1 |
| InChI | InChI=1S/C20H14FN3O2/c1-3-14-7-6-8-15(12-14)22-20(26)19-18(25)11-13(2)24(23-19)17-10-5-4-9-16(17)21/h1,4-12H,2H3,(H,22,26) |
| InChIKey | KMJVQYVOCQIFLK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|