C20H19FN4O2 — CID 92517374
N-[4-(dimethylamino)phenyl]-1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide (PubChem CID 92517374) has the molecular formula C20H19FN4O2 and a molecular weight of 366.40 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 92517374 |
| Molecular Formula | C20H19FN4O2 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2ccc(N(C)C)cc2)nn1-c1ccccc1F |
| InChI | InChI=1S/C20H19FN4O2/c1-13-12-18(26)19(23-25(13)17-7-5-4-6-16(17)21)20(27)22-14-8-10-15(11-9-14)24(2)3/h4-12H,1-3H3,(H,22,27) |
| InChIKey | WRCLKKWADLYTPT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|