C18H13ClFN3O2 — CID 9072335
1-(2-chlorophenyl)-N-(3-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide (PubChem CID 9072335) has the molecular formula C18H13ClFN3O2 and a molecular weight of 357.77 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(3-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-(3-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 9072335 |
| Molecular Formula | C18H13ClFN3O2 |
| Molecular Weight | 357.77 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(3-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2cccc(F)c2)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C18H13ClFN3O2/c1-11-9-16(24)17(18(25)21-13-6-4-5-12(20)10-13)22-23(11)15-8-3-2-7-14(15)19/h2-10H,1H3,(H,21,25) |
| InChIKey | AHWROWOXLIMEPG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.77 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |