C26H17F3N4O2 — CID 46554274
6-methyl-4-oxo-N-[3-(2-pyridin-2-ylethynyl)phenyl]-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide (PubChem CID 46554274) has the molecular formula C26H17F3N4O2 and a molecular weight of 474.44 g/mol. Its IUPAC name is 6-methyl-4-oxo-N-[3-(2-pyridin-2-ylethynyl)phenyl]-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide.
| Compound Name | 6-methyl-4-oxo-N-[3-(2-pyridin-2-ylethynyl)phenyl]-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 46554274 |
| Molecular Formula | C26H17F3N4O2 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 6-methyl-4-oxo-N-[3-(2-pyridin-2-ylethynyl)phenyl]-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2cccc(C#Cc3ccccn3)c2)nn1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C26H17F3N4O2/c1-17-15-23(34)24(32-33(17)22-11-3-2-10-21(22)26(27,28)29)25(35)31-20-9-6-7-18(16-20)12-13-19-8-4-5-14-30-19/h2-11,14-16H,1H3,(H,31,35) |
| InChIKey | CANYMMHTWLEZBJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|