C21H15FN4O2 — CID 26706128
1-(2-fluorophenyl)-6-methyl-4-oxo-N-quinolin-5-ylpyridazine-3-carboxamide (PubChem CID 26706128) has the molecular formula C21H15FN4O2 and a molecular weight of 374.38 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-6-methyl-4-oxo-N-quinolin-5-ylpyridazine-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-6-methyl-4-oxo-N-quinolin-5-ylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 26706128 |
| Molecular Formula | C21H15FN4O2 |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 1-(2-fluorophenyl)-6-methyl-4-oxo-N-quinolin-5-ylpyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2cccc3ncccc23)nn1-c1ccccc1F |
| InChI | InChI=1S/C21H15FN4O2/c1-13-12-19(27)20(25-26(13)18-10-3-2-7-15(18)22)21(28)24-17-9-4-8-16-14(17)6-5-11-23-16/h2-12H,1H3,(H,24,28) |
| InChIKey | DDFKMCGXQZSYJD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |