C22H16FN3O2S — CID 18284299
1-(2-fluorophenyl)-6-methyl-4-oxo-N-(2-thiophen-2-ylphenyl)pyridazine-3-carboxamide (PubChem CID 18284299) has the molecular formula C22H16FN3O2S and a molecular weight of 405.45 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-6-methyl-4-oxo-N-(2-thiophen-2-ylphenyl)pyridazine-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-6-methyl-4-oxo-N-(2-thiophen-2-ylphenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 18284299 |
| Molecular Formula | C22H16FN3O2S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 1-(2-fluorophenyl)-6-methyl-4-oxo-N-(2-thiophen-2-ylphenyl)pyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2ccccc2-c2cccs2)nn1-c1ccccc1F |
| InChI | InChI=1S/C22H16FN3O2S/c1-14-13-19(27)21(25-26(14)18-10-5-3-8-16(18)23)22(28)24-17-9-4-2-7-15(17)20-11-6-12-29-20/h2-13H,1H3,(H,24,28) |
| InChIKey | ZHGWDBYBZRUBHG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |