C9H8N2O3 — CID 91205767
(5-cyano-2-methoxyphenyl)carbamic acid (PubChem CID 91205767) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is (5-cyano-2-methoxyphenyl)carbamic acid.
| Compound Name | (5-cyano-2-methoxyphenyl)carbamic acid |
|---|---|
| PubChem CID | 91205767 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | (5-cyano-2-methoxyphenyl)carbamic acid |
| SMILES | COc1ccc(C#N)cc1NC(=O)O |
| InChI | InChI=1S/C9H8N2O3/c1-14-8-3-2-6(5-10)4-7(8)11-9(12)13/h2-4,11H,1H3,(H,12,13) |
| InChIKey | VDZQVQQYAWDJMR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |