C12H10F3N3O2 — CID 170168452
[1-(2-methylphenyl)-5-(trifluoromethyl)pyrazol-4-yl]carbamic acid (PubChem CID 170168452) has the molecular formula C12H10F3N3O2 and a molecular weight of 285.23 g/mol. Its IUPAC name is [1-(2-methylphenyl)-5-(trifluoromethyl)pyrazol-4-yl]carbamic acid.
| Compound Name | [1-(2-methylphenyl)-5-(trifluoromethyl)pyrazol-4-yl]carbamic acid |
|---|---|
| PubChem CID | 170168452 |
| Molecular Formula | C12H10F3N3O2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | [1-(2-methylphenyl)-5-(trifluoromethyl)pyrazol-4-yl]carbamic acid |
| SMILES | Cc1ccccc1-n1ncc(NC(=O)O)c1C(F)(F)F |
| InChI | InChI=1S/C12H10F3N3O2/c1-7-4-2-3-5-9(7)18-10(12(13,14)15)8(6-16-18)17-11(19)20/h2-6,17H,1H3,(H,19,20) |
| InChIKey | IUCGFGVMEUCKIS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |