C19H28FN5O — CID 55794068
1-[2-(2-cyano-3-fluoroanilino)ethyl]-3-[3-(4-methylpiperidin-1-yl)propyl]urea (PubChem CID 55794068) has the molecular formula C19H28FN5O and a molecular weight of 361.47 g/mol. Its IUPAC name is 1-[2-(2-cyano-3-fluoroanilino)ethyl]-3-[3-(4-methylpiperidin-1-yl)propyl]urea.
| Compound Name | 1-[2-(2-cyano-3-fluoroanilino)ethyl]-3-[3-(4-methylpiperidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 55794068 |
| Molecular Formula | C19H28FN5O |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 1-[2-(2-cyano-3-fluoroanilino)ethyl]-3-[3-(4-methylpiperidin-1-yl)propyl]urea |
| SMILES | CC1CCN(CCCNC(=O)NCCNc2cccc(F)c2C#N)CC1 |
| InChI | InChI=1S/C19H28FN5O/c1-15-6-12-25(13-7-15)11-3-8-23-19(26)24-10-9-22-18-5-2-4-17(20)16(18)14-21/h2,4-5,15,22H,3,6-13H2,1H3,(H2,23,24,26) |
| InChIKey | KKBYNQMIMQJIAV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 80.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|