C19H26F2N2O — CID 47888977
(E)-3-(2,6-difluorophenyl)-N-[4-(4-methylpiperidin-1-yl)butyl]prop-2-enamide (PubChem CID 47888977) has the molecular formula C19H26F2N2O and a molecular weight of 336.43 g/mol. Its IUPAC name is (E)-3-(2,6-difluorophenyl)-N-[4-(4-methylpiperidin-1-yl)butyl]prop-2-enamide.
| Compound Name | (E)-3-(2,6-difluorophenyl)-N-[4-(4-methylpiperidin-1-yl)butyl]prop-2-enamide |
|---|---|
| PubChem CID | 47888977 |
| Molecular Formula | C19H26F2N2O |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (E)-3-(2,6-difluorophenyl)-N-[4-(4-methylpiperidin-1-yl)butyl]prop-2-enamide |
| SMILES | CC1CCN(CCCCNC(=O)/C=C/c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C19H26F2N2O/c1-15-9-13-23(14-10-15)12-3-2-11-22-19(24)8-7-16-17(20)5-4-6-18(16)21/h4-8,15H,2-3,9-14H2,1H3,(H,22,24)/b8-7+ |
| InChIKey | XQYOKNXHKCGSTA-BQYQJAHWSA-N |
| XLogP | 3.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|