C11H11FN2S — CID 96824348
2-fluoro-N-[(1S)-1-(1,3-thiazol-2-yl)ethyl]aniline (PubChem CID 96824348) has the molecular formula C11H11FN2S and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-fluoro-N-[(1S)-1-(1,3-thiazol-2-yl)ethyl]aniline.
| Compound Name | 2-fluoro-N-[(1S)-1-(1,3-thiazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 96824348 |
| Molecular Formula | C11H11FN2S |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-fluoro-N-[(1S)-1-(1,3-thiazol-2-yl)ethyl]aniline |
| SMILES | C[C@H](Nc1ccccc1F)c1nccs1 |
| InChI | InChI=1S/C11H11FN2S/c1-8(11-13-6-7-15-11)14-10-5-3-2-4-9(10)12/h2-8,14H,1H3/t8-/m0/s1 |
| InChIKey | SBPUISYCPPEOHL-QMMMGPOBSA-N |
| XLogP | 3.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |