C14H16N2S2 — CID 64992944
2-prop-2-enylsulfanyl-N-[1-(1,3-thiazol-2-yl)ethyl]aniline (PubChem CID 64992944) has the molecular formula C14H16N2S2 and a molecular weight of 276.43 g/mol. Its IUPAC name is 2-prop-2-enylsulfanyl-N-[1-(1,3-thiazol-2-yl)ethyl]aniline.
| Compound Name | 2-prop-2-enylsulfanyl-N-[1-(1,3-thiazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 64992944 |
| Molecular Formula | C14H16N2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-prop-2-enylsulfanyl-N-[1-(1,3-thiazol-2-yl)ethyl]aniline |
| SMILES | C=CCSc1ccccc1NC(C)c1nccs1 |
| InChI | InChI=1S/C14H16N2S2/c1-3-9-17-13-7-5-4-6-12(13)16-11(2)14-15-8-10-18-14/h3-8,10-11,16H,1,9H2,2H3 |
| InChIKey | DBIKIDFUBIPSNC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|