C12H12F2N2OS — CID 64988333
2-(difluoromethoxy)-N-[1-(1,3-thiazol-2-yl)ethyl]aniline (PubChem CID 64988333) has the molecular formula C12H12F2N2OS and a molecular weight of 270.30 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[1-(1,3-thiazol-2-yl)ethyl]aniline.
| Compound Name | 2-(difluoromethoxy)-N-[1-(1,3-thiazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 64988333 |
| Molecular Formula | C12H12F2N2OS |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-(difluoromethoxy)-N-[1-(1,3-thiazol-2-yl)ethyl]aniline |
| SMILES | CC(Nc1ccccc1OC(F)F)c1nccs1 |
| InChI | InChI=1S/C12H12F2N2OS/c1-8(11-15-6-7-18-11)16-9-4-2-3-5-10(9)17-12(13)14/h2-8,12,16H,1H3 |
| InChIKey | PLIQXAOMXSDDRO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |