C10H11ClN4OS — CID 136896856
5-chloro-4-[2-(1,3-thiazol-2-yl)propylamino]-1H-pyrimidin-6-one (PubChem CID 136896856) has the molecular formula C10H11ClN4OS and a molecular weight of 270.75 g/mol. Its IUPAC name is 5-chloro-4-[2-(1,3-thiazol-2-yl)propylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[2-(1,3-thiazol-2-yl)propylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136896856 |
| Molecular Formula | C10H11ClN4OS |
| Molecular Weight | 270.75 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 5-chloro-4-[2-(1,3-thiazol-2-yl)propylamino]-1H-pyrimidin-6-one |
| SMILES | CC(CNc1nc[nH]c(=O)c1Cl)c1nccs1 |
| InChI | InChI=1S/C10H11ClN4OS/c1-6(10-12-2-3-17-10)4-13-8-7(11)9(16)15-5-14-8/h2-3,5-6H,4H2,1H3,(H2,13,14,15,16) |
| InChIKey | QZKPEZWIILKTIJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.75 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |