C9H7BrClN3OS — CID 136976452
4-[(3-bromothiophen-2-yl)methylamino]-5-chloro-1H-pyrimidin-6-one (PubChem CID 136976452) has the molecular formula C9H7BrClN3OS and a molecular weight of 320.60 g/mol. Its IUPAC name is 4-[(3-bromothiophen-2-yl)methylamino]-5-chloro-1H-pyrimidin-6-one.
| Compound Name | 4-[(3-bromothiophen-2-yl)methylamino]-5-chloro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136976452 |
| Molecular Formula | C9H7BrClN3OS |
| Molecular Weight | 320.60 g/mol |
| Exact Mass | 318.92 |
| IUPAC Name | 4-[(3-bromothiophen-2-yl)methylamino]-5-chloro-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCc2sccc2Br)c1Cl |
| InChI | InChI=1S/C9H7BrClN3OS/c10-5-1-2-16-6(5)3-12-8-7(11)9(15)14-4-13-8/h1-2,4H,3H2,(H2,12,13,14,15) |
| InChIKey | QHFIOSZGUWOZDL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.60 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |