C11H11ClN4O2 — CID 137016144
5-chloro-4-[(2-methoxy-3-pyridinyl)methylamino]-1H-pyrimidin-6-one (PubChem CID 137016144) has the molecular formula C11H11ClN4O2 and a molecular weight of 266.69 g/mol. Its IUPAC name is 5-chloro-4-[(2-methoxy-3-pyridinyl)methylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[(2-methoxy-3-pyridinyl)methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137016144 |
| Molecular Formula | C11H11ClN4O2 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 5-chloro-4-[(2-methoxy-3-pyridinyl)methylamino]-1H-pyrimidin-6-one |
| SMILES | COc1ncccc1CNc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C11H11ClN4O2/c1-18-11-7(3-2-4-13-11)5-14-9-8(12)10(17)16-6-15-9/h2-4,6H,5H2,1H3,(H2,14,15,16,17) |
| InChIKey | JAURTAPNOTTXKC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |