C14H17N3O3 — CID 136974266
5-methoxy-4-[[2-(methoxymethyl)phenyl]methylamino]-1H-pyrimidin-6-one (PubChem CID 136974266) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 5-methoxy-4-[[2-(methoxymethyl)phenyl]methylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-methoxy-4-[[2-(methoxymethyl)phenyl]methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136974266 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 5-methoxy-4-[[2-(methoxymethyl)phenyl]methylamino]-1H-pyrimidin-6-one |
| SMILES | COCc1ccccc1CNc1nc[nH]c(=O)c1OC |
| InChI | InChI=1S/C14H17N3O3/c1-19-8-11-6-4-3-5-10(11)7-15-13-12(20-2)14(18)17-9-16-13/h3-6,9H,7-8H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | VLYANESLMOJDET-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |