C12H12N4O4 — CID 136959376
5-[[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]methyl]pyridine-2-carboxylic acid (PubChem CID 136959376) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is 5-[[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]methyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 136959376 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 5-[[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]methyl]pyridine-2-carboxylic acid |
| SMILES | COc1c(NCc2ccc(C(=O)O)nc2)nc[nH]c1=O |
| InChI | InChI=1S/C12H12N4O4/c1-20-9-10(15-6-16-11(9)17)14-5-7-2-3-8(12(18)19)13-4-7/h2-4,6H,5H2,1H3,(H,18,19)(H2,14,15,16,17) |
| InChIKey | WRHGLXKTXRDYOO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |