C9H12N6O2 — CID 136978664
4-[(5-amino-1H-pyrazol-4-yl)methylamino]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136978664) has the molecular formula C9H12N6O2 and a molecular weight of 236.24 g/mol. Its IUPAC name is 4-[(5-amino-1H-pyrazol-4-yl)methylamino]-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-[(5-amino-1H-pyrazol-4-yl)methylamino]-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136978664 |
| Molecular Formula | C9H12N6O2 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 4-[(5-amino-1H-pyrazol-4-yl)methylamino]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(NCc2cn[nH]c2N)nc[nH]c1=O |
| InChI | InChI=1S/C9H12N6O2/c1-17-6-8(12-4-13-9(6)16)11-2-5-3-14-15-7(5)10/h3-4H,2H2,1H3,(H3,10,14,15)(H2,11,12,13,16) |
| InChIKey | PTKXNMVOKNIPEK-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |