C10H10ClN3OS — CID 136975243
5-chloro-4-[(5-methylthiophen-2-yl)methylamino]-1H-pyrimidin-6-one (PubChem CID 136975243) has the molecular formula C10H10ClN3OS and a molecular weight of 255.73 g/mol. Its IUPAC name is 5-chloro-4-[(5-methylthiophen-2-yl)methylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[(5-methylthiophen-2-yl)methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136975243 |
| Molecular Formula | C10H10ClN3OS |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 5-chloro-4-[(5-methylthiophen-2-yl)methylamino]-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(CNc2nc[nH]c(=O)c2Cl)s1 |
| InChI | InChI=1S/C10H10ClN3OS/c1-6-2-3-7(16-6)4-12-9-8(11)10(15)14-5-13-9/h2-3,5H,4H2,1H3,(H2,12,13,14,15) |
| InChIKey | SFNHWEQEQKQSCY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |