C11H7BrClF3N2S — CID 78983980
N-[(3-bromothiophen-2-yl)methyl]-3-chloro-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 78983980) has the molecular formula C11H7BrClF3N2S and a molecular weight of 371.61 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-3-chloro-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-3-chloro-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 78983980 |
| Molecular Formula | C11H7BrClF3N2S |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 369.92 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-3-chloro-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cnc(NCc2sccc2Br)c(Cl)c1 |
| InChI | InChI=1S/C11H7BrClF3N2S/c12-7-1-2-19-9(7)5-18-10-8(13)3-6(4-17-10)11(14,15)16/h1-4H,5H2,(H,17,18) |
| InChIKey | NGJDYLRUHCTPPJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |