C15H14ClF3N2O — CID 97020715
(1S)-1-[4-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]phenyl]ethanol (PubChem CID 97020715) has the molecular formula C15H14ClF3N2O and a molecular weight of 330.74 g/mol. Its IUPAC name is (1S)-1-[4-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]phenyl]ethanol.
| Compound Name | (1S)-1-[4-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]phenyl]ethanol |
|---|---|
| PubChem CID | 97020715 |
| Molecular Formula | C15H14ClF3N2O |
| Molecular Weight | 330.74 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (1S)-1-[4-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]phenyl]ethanol |
| SMILES | C[C@H](O)c1ccc(CNc2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C15H14ClF3N2O/c1-9(22)11-4-2-10(3-5-11)7-20-14-13(16)6-12(8-21-14)15(17,18)19/h2-6,8-9,22H,7H2,1H3,(H,20,21)/t9-/m0/s1 |
| InChIKey | BDIXDKRWWBOYQU-VIFPVBQESA-N |
| XLogP | 4.42 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.74 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |