C9H10ClF3N2O — CID 43388784
1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propan-2-ol (PubChem CID 43388784) has the molecular formula C9H10ClF3N2O and a molecular weight of 254.64 g/mol. Its IUPAC name is 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propan-2-ol.
| Compound Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 43388784 |
| Molecular Formula | C9H10ClF3N2O |
| Molecular Weight | 254.64 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propan-2-ol |
| SMILES | CC(O)CNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C9H10ClF3N2O/c1-5(16)3-14-8-7(10)2-6(4-15-8)9(11,12)13/h2,4-5,16H,3H2,1H3,(H,14,15) |
| InChIKey | BUWHSBADQKRBBQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.64 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |