C14H11ClF4N2O — CID 52579767
(1R)-2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-1-(2-fluorophenyl)ethanol (PubChem CID 52579767) has the molecular formula C14H11ClF4N2O and a molecular weight of 334.70 g/mol. Its IUPAC name is (1R)-2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-1-(2-fluorophenyl)ethanol.
| Compound Name | (1R)-2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-1-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 52579767 |
| Molecular Formula | C14H11ClF4N2O |
| Molecular Weight | 334.70 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | (1R)-2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-1-(2-fluorophenyl)ethanol |
| SMILES | O[C@@H](CNc1ncc(C(F)(F)F)cc1Cl)c1ccccc1F |
| InChI | InChI=1S/C14H11ClF4N2O/c15-10-5-8(14(17,18)19)6-20-13(10)21-7-12(22)9-3-1-2-4-11(9)16/h1-6,12,22H,7H2,(H,20,21)/t12-/m0/s1 |
| InChIKey | XJWXDYZPIJITHZ-LBPRGKRZSA-N |
| XLogP | 4.04 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.70 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |