C14H11ClF5N3O2S — CID 35405703
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2,6-difluorobenzenesulfonamide (PubChem CID 35405703) has the molecular formula C14H11ClF5N3O2S and a molecular weight of 415.77 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2,6-difluorobenzenesulfonamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 35405703 |
| Molecular Formula | C14H11ClF5N3O2S |
| Molecular Weight | 415.77 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2,6-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1ncc(C(F)(F)F)cc1Cl)c1c(F)cccc1F |
| InChI | InChI=1S/C14H11ClF5N3O2S/c15-9-6-8(14(18,19)20)7-22-13(9)21-4-5-23-26(24,25)12-10(16)2-1-3-11(12)17/h1-3,6-7,23H,4-5H2,(H,21,22) |
| InChIKey | ZKPWDWZVMUGLJF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.77 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|