C14H15ClF3N5O4S — CID 26530235
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 26530235) has the molecular formula C14H15ClF3N5O4S and a molecular weight of 441.82 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 26530235 |
| Molecular Formula | C14H15ClF3N5O4S |
| Molecular Weight | 441.82 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NCCNc2ncc(C(F)(F)F)cc2Cl)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H15ClF3N5O4S/c1-22-7-10(12(24)23(2)13(22)25)28(26,27)21-4-3-19-11-9(15)5-8(6-20-11)14(16,17)18/h5-7,21H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | VWXNJHJPNKYWRY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.82 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|