C12H10ClF3N4O3 — CID 2767258
1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 2767258) has the molecular formula C12H10ClF3N4O3 and a molecular weight of 350.68 g/mol. Its IUPAC name is 1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2767258 |
| Molecular Formula | C12H10ClF3N4O3 |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1CC(=O)N(CCNc2ncc(C(F)(F)F)cc2Cl)C(=O)N1 |
| InChI | InChI=1S/C12H10ClF3N4O3/c13-7-3-6(12(14,15)16)5-18-10(7)17-1-2-20-9(22)4-8(21)19-11(20)23/h3,5H,1-2,4H2,(H,17,18)(H,19,21,23) |
| InChIKey | REEJVBFGMCHOHY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|